C23H24O11 — CID 78112548
2-(3,4-dihydroxyphenyl)ethenyl 3-[4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate (PubChem CID 78112548) has the molecular formula C23H24O11 and a molecular weight of 476.43 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)ethenyl 3-[4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate.
| Compound Name | 2-(3,4-dihydroxyphenyl)ethenyl 3-[4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 78112548 |
| Molecular Formula | C23H24O11 |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)ethenyl 3-[4-hydroxy-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O)c(OC2OC(CO)C(O)C(O)C2O)c1)OC=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C23H24O11/c24-11-18-20(29)21(30)22(31)23(34-18)33-17-10-12(2-5-15(17)26)3-6-19(28)32-8-7-13-1-4-14(25)16(27)9-13/h1-10,18,20-27,29-31H,11H2 |
| InChIKey | PHEWRRKXSZNFND-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 186.37 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|