C23H26O10 — CID 162915698
1-(3,4-dihydroxyphenyl)-5-[4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]pent-4-en-1-one (PubChem CID 162915698) has the molecular formula C23H26O10 and a molecular weight of 462.45 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-5-[4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]pent-4-en-1-one.
| Compound Name | 1-(3,4-dihydroxyphenyl)-5-[4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]pent-4-en-1-one |
|---|---|
| PubChem CID | 162915698 |
| Molecular Formula | C23H26O10 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-5-[4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]pent-4-en-1-one |
| SMILES | O=C(CCC=Cc1ccc(O)c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C23H26O10/c24-11-19-20(29)21(30)22(31)23(33-19)32-18-9-12(5-7-16(18)27)3-1-2-4-14(25)13-6-8-15(26)17(28)10-13/h1,3,5-10,19-24,26-31H,2,4,11H2/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | QNHAEHZQGILIPY-XNBWIAOKSA-N |
| XLogP | 0.66 |
| TPSA | 177.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|