C30H28O12 — CID 162943297
[(2R,3R,4S,5R,6S)-6-[3,5-dihydroxy-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 162943297) has the molecular formula C30H28O12 and a molecular weight of 580.54 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-6-[3,5-dihydroxy-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3R,4S,5R,6S)-6-[3,5-dihydroxy-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162943297 |
| Molecular Formula | C30H28O12 |
| Molecular Weight | 580.54 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-6-[3,5-dihydroxy-2-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)cc1)OC[C@H]1O[C@@H](Oc2cc(O)cc(O)c2C(=O)/C=C/c2ccc(O)cc2)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C30H28O12/c31-18-7-1-16(2-8-18)5-11-21(34)26-22(35)13-20(33)14-23(26)41-30-29(39)28(38)27(37)24(42-30)15-40-25(36)12-6-17-3-9-19(32)10-4-17/h1-14,24,27-33,35,37-39H,15H2/b11-5+,12-6+/t24-,27+,28+,29-,30-/m1/s1 |
| InChIKey | WGZRJKFSELNVFI-NKTIHWTASA-N |
| XLogP | 1.85 |
| TPSA | 203.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.54 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|