C30H26O15 — CID 162898251
[(2R,3S,4R,5S,6R)-6-[2,3-dihydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 162898251) has the molecular formula C30H26O15 and a molecular weight of 626.52 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-6-[2,3-dihydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3S,4R,5S,6R)-6-[2,3-dihydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162898251 |
| Molecular Formula | C30H26O15 |
| Molecular Weight | 626.52 g/mol |
| Exact Mass | 626.13 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-6-[2,3-dihydroxy-5-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O)cc1)OC[C@H]1O[C@H](Oc2cc(-c3oc4cc(O)cc(O)c4c(=O)c3O)cc(O)c2O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H26O15/c31-14-4-1-12(2-5-14)3-6-21(35)42-11-20-24(37)26(39)28(41)30(45-20)44-19-8-13(7-17(34)23(19)36)29-27(40)25(38)22-16(33)9-15(32)10-18(22)43-29/h1-10,20,24,26,28,30-34,36-37,39-41H,11H2/t20-,24-,26-,28+,30+/m1/s1 |
| InChIKey | PHEXVBOYEBOWGX-MWNDIGCZSA-N |
| XLogP | 1.14 |
| TPSA | 257.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.52 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|