C20H20O9 — CID 163045080
(E)-1-[2,4-dihydroxy-6-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 163045080) has the molecular formula C20H20O9 and a molecular weight of 404.37 g/mol. Its IUPAC name is (E)-1-[2,4-dihydroxy-6-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2,4-dihydroxy-6-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 163045080 |
| Molecular Formula | C20H20O9 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | (E)-1-[2,4-dihydroxy-6-[(2R,3R,4R,5R)-3,4,5-trihydroxyoxan-2-yl]oxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(O)cc1)c1c(O)cc(O)cc1O[C@H]1OC[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H20O9/c21-11-4-1-10(2-5-11)3-6-13(23)17-14(24)7-12(22)8-16(17)29-20-19(27)18(26)15(25)9-28-20/h1-8,15,18-22,24-27H,9H2/b6-3+/t15-,18-,19-,20-/m1/s1 |
| InChIKey | YFTPPEJHVJJJMC-ZHFDAXOLSA-N |
| XLogP | 0.52 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|