C22H24O9 — CID 130394862
(E)-1-[4-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-2,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 130394862) has the molecular formula C22H24O9 and a molecular weight of 432.43 g/mol. Its IUPAC name is (E)-1-[4-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-2,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-2,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 130394862 |
| Molecular Formula | C22H24O9 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | (E)-1-[4-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-methyloxan-2-yl]oxy-2,6-dihydroxyphenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | C[C@H]1[C@H](Oc2cc(O)c(C(=O)/C=C/c3ccc(O)cc3)c(O)c2)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H24O9/c1-11-20(28)21(29)18(10-23)31-22(11)30-14-8-16(26)19(17(27)9-14)15(25)7-4-12-2-5-13(24)6-3-12/h2-9,11,18,20-24,26-29H,10H2,1H3/b7-4+/t11-,18-,20-,21-,22-/m1/s1 |
| InChIKey | HPXRSHJLJCNSTI-ZTLJJJCPSA-N |
| XLogP | 1.15 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|