C28H32O8 — CID 165077172
(1E,6E)-1-[4-[(2S,3R,4S,5S,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxy-3-methylphenyl]-7-(4-hydroxy-3-methylphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 165077172) has the molecular formula C28H32O8 and a molecular weight of 496.56 g/mol. Its IUPAC name is (1E,6E)-1-[4-[(2S,3R,4S,5S,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxy-3-methylphenyl]-7-(4-hydroxy-3-methylphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-[4-[(2S,3R,4S,5S,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxy-3-methylphenyl]-7-(4-hydroxy-3-methylphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 165077172 |
| Molecular Formula | C28H32O8 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | (1E,6E)-1-[4-[(2S,3R,4S,5S,6R)-3,5-dihydroxy-6-(hydroxymethyl)-4-methyloxan-2-yl]oxy-3-methylphenyl]-7-(4-hydroxy-3-methylphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | Cc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](C)[C@H]3O)c(C)c2)ccc1O |
| InChI | InChI=1S/C28H32O8/c1-16-12-19(6-10-23(16)32)4-8-21(30)14-22(31)9-5-20-7-11-24(17(2)13-20)35-28-27(34)18(3)26(33)25(15-29)36-28/h4-13,18,25-29,32-34H,14-15H2,1-3H3/b8-4+,9-5+/t18-,25+,26-,27+,28+/m0/s1 |
| InChIKey | YDPGFUHFUXOQFZ-TWGIDLLPSA-N |
| XLogP | 2.72 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|