C16H16O11 — CID 163077718
3,4,5-trihydroxy-6-(8-hydroxy-6-methoxy-2-oxochromen-7-yl)oxyoxane-2-carboxylic acid (PubChem CID 163077718) has the molecular formula C16H16O11 and a molecular weight of 384.29 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-(8-hydroxy-6-methoxy-2-oxochromen-7-yl)oxyoxane-2-carboxylic acid.
| Compound Name | 3,4,5-trihydroxy-6-(8-hydroxy-6-methoxy-2-oxochromen-7-yl)oxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163077718 |
| Molecular Formula | C16H16O11 |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 3,4,5-trihydroxy-6-(8-hydroxy-6-methoxy-2-oxochromen-7-yl)oxyoxane-2-carboxylic acid |
| SMILES | COc1cc2ccc(=O)oc2c(O)c1OC1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C16H16O11/c1-24-6-4-5-2-3-7(17)25-12(5)11(21)13(6)26-16-10(20)8(18)9(19)14(27-16)15(22)23/h2-4,8-10,14,16,18-21H,1H3,(H,22,23) |
| InChIKey | ZHKAJLJMDJPZQR-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 176.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|