C23H22O11 — CID 171115190
6-(7,8-dimethoxy-2-oxo-4-phenylchromen-6-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 171115190) has the molecular formula C23H22O11 and a molecular weight of 474.42 g/mol. Its IUPAC name is 6-(7,8-dimethoxy-2-oxo-4-phenylchromen-6-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-(7,8-dimethoxy-2-oxo-4-phenylchromen-6-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 171115190 |
| Molecular Formula | C23H22O11 |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 6-(7,8-dimethoxy-2-oxo-4-phenylchromen-6-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | COc1c(OC2OC(C(=O)O)C(O)C(O)C2O)cc2c(-c3ccccc3)cc(=O)oc2c1OC |
| InChI | InChI=1S/C23H22O11/c1-30-19-13(32-23-17(27)15(25)16(26)20(34-23)22(28)29)8-12-11(10-6-4-3-5-7-10)9-14(24)33-18(12)21(19)31-2/h3-9,15-17,20,23,25-27H,1-2H3,(H,28,29) |
| InChIKey | IIVUUKOCHDQIKM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 165.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|