C29H28O11 — CID 162837162
6-[(9,10-dimethoxy-1-phenyl-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 162837162) has the molecular formula C29H28O11 and a molecular weight of 552.53 g/mol. Its IUPAC name is 6-[(9,10-dimethoxy-1-phenyl-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[(9,10-dimethoxy-1-phenyl-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 162837162 |
| Molecular Formula | C29H28O11 |
| Molecular Weight | 552.53 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | 6-[(9,10-dimethoxy-1-phenyl-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | COc1ccc2c(c1OC)OC1c3c(cc(OC4OC(C(=O)O)C(O)C(O)C4O)cc3-c3ccccc3)OCC21 |
| InChI | InChI=1S/C29H28O11/c1-35-18-9-8-15-17-12-37-19-11-14(38-29-23(32)21(30)22(31)27(40-29)28(33)34)10-16(13-6-4-3-5-7-13)20(19)24(17)39-25(15)26(18)36-2/h3-11,17,21-24,27,29-32H,12H2,1-2H3,(H,33,34) |
| InChIKey | BCJBKKRTCJUIMA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |