C24H24O13 — CID 154699789
(2S,3S,4S,5R)-3,4,5-trihydroxy-6-[7-hydroxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxyoxane-2-carboxylic acid (PubChem CID 154699789) has the molecular formula C24H24O13 and a molecular weight of 520.44 g/mol. Its IUPAC name is (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[7-hydroxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[7-hydroxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 154699789 |
| Molecular Formula | C24H24O13 |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[7-hydroxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxyoxane-2-carboxylic acid |
| SMILES | COc1cc(-c2oc3cc(O)ccc3c(=O)c2OC2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)cc(OC)c1OC |
| InChI | InChI=1S/C24H24O13/c1-32-13-6-9(7-14(33-2)20(13)34-3)19-21(15(26)11-5-4-10(25)8-12(11)35-19)36-24-18(29)16(27)17(28)22(37-24)23(30)31/h4-8,16-18,22,24-25,27-29H,1-3H3,(H,30,31)/t16-,17-,18+,22-,24?/m0/s1 |
| InChIKey | MGPJRQXFVAPOKA-HKBOJXCQSA-N |
| XLogP | 0.46 |
| TPSA | 194.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |