C17H20O10 — CID 131839192
3,4,5-trihydroxy-6-[5-hydroxy-2-methoxy-4-[(E)-3-oxobut-1-enyl]phenoxy]oxane-2-carboxylic acid (PubChem CID 131839192) has the molecular formula C17H20O10 and a molecular weight of 384.34 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-[5-hydroxy-2-methoxy-4-[(E)-3-oxobut-1-enyl]phenoxy]oxane-2-carboxylic acid.
| Compound Name | 3,4,5-trihydroxy-6-[5-hydroxy-2-methoxy-4-[(E)-3-oxobut-1-enyl]phenoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 131839192 |
| Molecular Formula | C17H20O10 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 3,4,5-trihydroxy-6-[5-hydroxy-2-methoxy-4-[(E)-3-oxobut-1-enyl]phenoxy]oxane-2-carboxylic acid |
| SMILES | COc1cc(/C=C/C(C)=O)c(O)cc1OC1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C17H20O10/c1-7(18)3-4-8-5-10(25-2)11(6-9(8)19)26-17-14(22)12(20)13(21)15(27-17)16(23)24/h3-6,12-15,17,19-22H,1-2H3,(H,23,24)/b4-3+ |
| InChIKey | HXSYGAKMOZDSKG-ONEGZZNKSA-N |
| XLogP | -0.73 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|