C18H21O9P — CID 123363099
[3-[2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-hydroxy-6-methoxyphenyl] dihydrogen phosphate (PubChem CID 123363099) has the molecular formula C18H21O9P and a molecular weight of 412.33 g/mol. Its IUPAC name is [3-[2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-hydroxy-6-methoxyphenyl] dihydrogen phosphate.
| Compound Name | [3-[2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-hydroxy-6-methoxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 123363099 |
| Molecular Formula | C18H21O9P |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [3-[2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-hydroxy-6-methoxyphenyl] dihydrogen phosphate |
| SMILES | COc1cc(C=Cc2ccc(OC)c(OP(=O)(O)O)c2O)cc(CO)c1CO |
| InChI | InChI=1S/C18H21O9P/c1-25-15-6-5-12(17(21)18(15)27-28(22,23)24)4-3-11-7-13(9-19)14(10-20)16(8-11)26-2/h3-8,19-21H,9-10H2,1-2H3,(H2,22,23,24) |
| InChIKey | CLGUGBXRCSPKJS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|