C19H23O8P — CID 118421920
[5-[(Z)-2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-methoxyphenyl] methyl hydrogen phosphate (PubChem CID 118421920) has the molecular formula C19H23O8P and a molecular weight of 410.36 g/mol. Its IUPAC name is [5-[(Z)-2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-methoxyphenyl] methyl hydrogen phosphate.
| Compound Name | [5-[(Z)-2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-methoxyphenyl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 118421920 |
| Molecular Formula | C19H23O8P |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | [5-[(Z)-2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-methoxyphenyl] methyl hydrogen phosphate |
| SMILES | COc1ccc(/C=C\c2cc(CO)c(CO)c(OC)c2)cc1OP(=O)(O)OC |
| InChI | InChI=1S/C19H23O8P/c1-24-17-7-6-13(9-19(17)27-28(22,23)26-3)4-5-14-8-15(11-20)16(12-21)18(10-14)25-2/h4-10,20-21H,11-12H2,1-3H3,(H,22,23)/b5-4- |
| InChIKey | FVLMRXNNVLQQDZ-PLNGDYQASA-N |
| XLogP | 2.98 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|