C19H20O5 — CID 89014921
5-[(Z)-2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-(oxiran-2-yl)phenol (PubChem CID 89014921) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is 5-[(Z)-2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-(oxiran-2-yl)phenol.
| Compound Name | 5-[(Z)-2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-(oxiran-2-yl)phenol |
|---|---|
| PubChem CID | 89014921 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 5-[(Z)-2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-(oxiran-2-yl)phenol |
| SMILES | COc1cc(/C=C\c2ccc(C3CO3)c(O)c2)cc(CO)c1CO |
| InChI | InChI=1S/C19H20O5/c1-23-18-8-13(6-14(9-20)16(18)10-21)3-2-12-4-5-15(17(22)7-12)19-11-24-19/h2-8,19-22H,9-11H2,1H3/b3-2- |
| InChIKey | COMABCYHSKUDOS-IHWYPQMZSA-N |
| XLogP | 2.63 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|