C19H18F3NO6 — CID 89207407
[2-(hydroxymethyl)-3-methoxy-5-[(Z)-2-[3-nitro-4-(2,2,2-trifluoroethoxy)phenyl]ethenyl]phenyl]methanol (PubChem CID 89207407) has the molecular formula C19H18F3NO6 and a molecular weight of 413.35 g/mol. Its IUPAC name is [2-(hydroxymethyl)-3-methoxy-5-[(Z)-2-[3-nitro-4-(2,2,2-trifluoroethoxy)phenyl]ethenyl]phenyl]methanol.
| Compound Name | [2-(hydroxymethyl)-3-methoxy-5-[(Z)-2-[3-nitro-4-(2,2,2-trifluoroethoxy)phenyl]ethenyl]phenyl]methanol |
|---|---|
| PubChem CID | 89207407 |
| Molecular Formula | C19H18F3NO6 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [2-(hydroxymethyl)-3-methoxy-5-[(Z)-2-[3-nitro-4-(2,2,2-trifluoroethoxy)phenyl]ethenyl]phenyl]methanol |
| SMILES | COc1cc(/C=C\c2ccc(OCC(F)(F)F)c([N+](=O)[O-])c2)cc(CO)c1CO |
| InChI | InChI=1S/C19H18F3NO6/c1-28-18-8-13(6-14(9-24)15(18)10-25)3-2-12-4-5-17(16(7-12)23(26)27)29-11-19(20,21)22/h2-8,24-25H,9-11H2,1H3/b3-2- |
| InChIKey | ABGHYNBQZODGOU-IHWYPQMZSA-N |
| XLogP | 3.70 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|