(E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid

C12H14O5 — CID 155606413

IUPAC(E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid
SMILESCOc1cc(/C=C/C(=O)O)cc(CO)c1CO
InChIInChI=1S/C12H14O5/c1-17-11-5-8(2-3-12(15)16)4-9(6-13)10(11)7-14/h2-5,13-14H,6-7H2,1H3,(H,15,16)/b3-2+
InChIKeyKGQARWQKQZORJY-NSCUHMNNSA-N
MW238.24 g/mol
LogP0.78
Rot. Bonds5

About (E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid

(E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid (PubChem CID 155606413) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is (E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid
PubChem CID155606413
Molecular FormulaC12H14O5
Molecular Weight238.24 g/mol
Exact Mass238.08
IUPAC Name(E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid
SMILESCOc1cc(/C=C/C(=O)O)cc(CO)c1CO
InChIInChI=1S/C12H14O5/c1-17-11-5-8(2-3-12(15)16)4-9(6-13)10(11)7-14/h2-5,13-14H,6-7H2,1H3,(H,15,16)/b3-2+
InChIKeyKGQARWQKQZORJY-NSCUHMNNSA-N
XLogP0.78
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.24
LogP ≤ 50.78
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid?
The IUPAC name of (E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid (CID 155606413) is (E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid.
What is the SMILES notation for (E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid?
The canonical SMILES for (E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid is COc1cc(/C=C/C(=O)O)cc(CO)c1CO.
What is the InChIKey of (E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid?
The InChIKey is KGQARWQKQZORJY-NSCUHMNNSA-N. The full InChI is InChI=1S/C12H14O5/c1-17-11-5-8(2-3-12(15)16)4-9(6-13)10(11)7-14/h2-5,13-14H,6-7H2,1H3,(H,15,16)/b3-2+.
What are the key properties of (E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid?
(E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid has a molecular weight of 238.24 g/mol, XLogP of 0.78, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid is sourced from PubChem (CID 155606413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).