C18H18O8 — CID 155606414
(5-hydroxy-4-oxopyran-2-yl)methyl (E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoate (PubChem CID 155606414) has the molecular formula C18H18O8 and a molecular weight of 362.33 g/mol. Its IUPAC name is (5-hydroxy-4-oxopyran-2-yl)methyl (E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoate.
| Compound Name | (5-hydroxy-4-oxopyran-2-yl)methyl (E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 155606414 |
| Molecular Formula | C18H18O8 |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (5-hydroxy-4-oxopyran-2-yl)methyl (E)-3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCc2cc(=O)c(O)co2)cc(CO)c1CO |
| InChI | InChI=1S/C18H18O8/c1-24-17-5-11(4-12(7-19)14(17)8-20)2-3-18(23)26-9-13-6-15(21)16(22)10-25-13/h2-6,10,19-20,22H,7-9H2,1H3/b3-2+ |
| InChIKey | HVBJGIKGBBEANX-NSCUHMNNSA-N |
| XLogP | 1.10 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|