C18H19IO5 — CID 118421918
4-[(Z)-2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-(hydroxymethyl)-5-iodophenol (PubChem CID 118421918) has the molecular formula C18H19IO5 and a molecular weight of 442.25 g/mol. Its IUPAC name is 4-[(Z)-2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-(hydroxymethyl)-5-iodophenol.
| Compound Name | 4-[(Z)-2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-(hydroxymethyl)-5-iodophenol |
|---|---|
| PubChem CID | 118421918 |
| Molecular Formula | C18H19IO5 |
| Molecular Weight | 442.25 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 4-[(Z)-2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2-(hydroxymethyl)-5-iodophenol |
| SMILES | COc1cc(/C=C\c2cc(CO)c(O)cc2I)cc(CO)c1CO |
| InChI | InChI=1S/C18H19IO5/c1-24-18-5-11(4-13(8-20)15(18)10-22)2-3-12-6-14(9-21)17(23)7-16(12)19/h2-7,20-23H,8-10H2,1H3/b3-2- |
| InChIKey | DLNOXFBXXMLWFQ-IHWYPQMZSA-N |
| XLogP | 2.65 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|