C19H22O6 — CID 89269608
3-[(Z)-2-[3-(hydroxymethyl)-4,5-dimethoxyphenyl]ethenyl]-2,6-dimethoxyphenol (PubChem CID 89269608) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is 3-[(Z)-2-[3-(hydroxymethyl)-4,5-dimethoxyphenyl]ethenyl]-2,6-dimethoxyphenol.
| Compound Name | 3-[(Z)-2-[3-(hydroxymethyl)-4,5-dimethoxyphenyl]ethenyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 89269608 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3-[(Z)-2-[3-(hydroxymethyl)-4,5-dimethoxyphenyl]ethenyl]-2,6-dimethoxyphenol |
| SMILES | COc1ccc(/C=C\c2cc(CO)c(OC)c(OC)c2)c(OC)c1O |
| InChI | InChI=1S/C19H22O6/c1-22-15-8-7-13(19(25-4)17(15)21)6-5-12-9-14(11-20)18(24-3)16(10-12)23-2/h5-10,20-21H,11H2,1-4H3/b6-5- |
| InChIKey | KDVYVCIYRSRYMR-WAYWQWQTSA-N |
| XLogP | 3.09 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|