C28H32O10S — CID 159050688
6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-[(3,4,5-trimethoxyphenyl)sulfonylmethyl]phenol (PubChem CID 159050688) has the molecular formula C28H32O10S and a molecular weight of 560.62 g/mol. Its IUPAC name is 6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-[(3,4,5-trimethoxyphenyl)sulfonylmethyl]phenol.
| Compound Name | 6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-[(3,4,5-trimethoxyphenyl)sulfonylmethyl]phenol |
|---|---|
| PubChem CID | 159050688 |
| Molecular Formula | C28H32O10S |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | 6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]-2-[(3,4,5-trimethoxyphenyl)sulfonylmethyl]phenol |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)c(CS(=O)(=O)c2cc(OC)c(OC)c(OC)c2)c1O |
| InChI | InChI=1S/C28H32O10S/c1-32-21-11-10-18(9-8-17-12-22(33-2)27(37-6)23(13-17)34-3)20(26(21)29)16-39(30,31)19-14-24(35-4)28(38-7)25(15-19)36-5/h8-15,29H,16H2,1-7H3/b9-8- |
| InChIKey | BZBGZYJCGIVOKB-HJWRWDBZSA-N |
| XLogP | 4.60 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|