C26H27NO9S — CID 158056126
1,2-dimethoxy-3-[(4-nitrophenyl)sulfonylmethyl]-4-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzene (PubChem CID 158056126) has the molecular formula C26H27NO9S and a molecular weight of 529.57 g/mol. Its IUPAC name is 1,2-dimethoxy-3-[(4-nitrophenyl)sulfonylmethyl]-4-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzene.
| Compound Name | 1,2-dimethoxy-3-[(4-nitrophenyl)sulfonylmethyl]-4-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 158056126 |
| Molecular Formula | C26H27NO9S |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 1,2-dimethoxy-3-[(4-nitrophenyl)sulfonylmethyl]-4-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzene |
| SMILES | COc1cc(/C=C\c2ccc(OC)c(OC)c2CS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H27NO9S/c1-32-22-13-8-18(7-6-17-14-23(33-2)26(36-5)24(15-17)34-3)21(25(22)35-4)16-37(30,31)20-11-9-19(10-12-20)27(28)29/h6-15H,16H2,1-5H3/b7-6- |
| InChIKey | CVXGKRIWWMLIFM-SREVYHEPSA-N |
| XLogP | 4.78 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|