C24H25NO5S — CID 162078157
4-[[2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]methylsulfonyl]aniline (PubChem CID 162078157) has the molecular formula C24H25NO5S and a molecular weight of 439.53 g/mol. Its IUPAC name is 4-[[2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]methylsulfonyl]aniline.
| Compound Name | 4-[[2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]methylsulfonyl]aniline |
|---|---|
| PubChem CID | 162078157 |
| Molecular Formula | C24H25NO5S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 4-[[2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]methylsulfonyl]aniline |
| SMILES | COc1cc(/C=C\c2ccccc2CS(=O)(=O)c2ccc(N)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H25NO5S/c1-28-22-14-17(15-23(29-2)24(22)30-3)8-9-18-6-4-5-7-19(18)16-31(26,27)21-12-10-20(25)11-13-21/h4-15H,16,25H2,1-3H3/b9-8- |
| InChIKey | ABONHPRUJJGXFP-HJWRWDBZSA-N |
| XLogP | 4.44 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|