C25H25ClO7S — CID 159528223
4-[(4-chlorophenyl)sulfonylmethyl]-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol (PubChem CID 159528223) has the molecular formula C25H25ClO7S and a molecular weight of 504.99 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)sulfonylmethyl]-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol.
| Compound Name | 4-[(4-chlorophenyl)sulfonylmethyl]-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 159528223 |
| Molecular Formula | C25H25ClO7S |
| Molecular Weight | 504.99 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 4-[(4-chlorophenyl)sulfonylmethyl]-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
| SMILES | COc1cc(CS(=O)(=O)c2ccc(Cl)cc2)c(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C25H25ClO7S/c1-30-22-14-18(15-34(28,29)20-9-7-19(26)8-10-20)17(13-21(22)27)6-5-16-11-23(31-2)25(33-4)24(12-16)32-3/h5-14,27H,15H2,1-4H3/b6-5- |
| InChIKey | GFKIQLZKGWHHMY-WAYWQWQTSA-N |
| XLogP | 5.22 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.99 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|