C26H27ClO8S — CID 159347898
3-[(3-chloro-4-methoxyphenyl)sulfonylmethyl]-2-methoxy-4-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol (PubChem CID 159347898) has the molecular formula C26H27ClO8S and a molecular weight of 535.01 g/mol. Its IUPAC name is 3-[(3-chloro-4-methoxyphenyl)sulfonylmethyl]-2-methoxy-4-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol.
| Compound Name | 3-[(3-chloro-4-methoxyphenyl)sulfonylmethyl]-2-methoxy-4-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 159347898 |
| Molecular Formula | C26H27ClO8S |
| Molecular Weight | 535.01 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 3-[(3-chloro-4-methoxyphenyl)sulfonylmethyl]-2-methoxy-4-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
| SMILES | COc1ccc(S(=O)(=O)Cc2c(/C=C\c3cc(OC)c(OC)c(OC)c3)ccc(O)c2OC)cc1Cl |
| InChI | InChI=1S/C26H27ClO8S/c1-31-22-11-9-18(14-20(22)27)36(29,30)15-19-17(8-10-21(28)25(19)34-4)7-6-16-12-23(32-2)26(35-5)24(13-16)33-3/h6-14,28H,15H2,1-5H3/b7-6- |
| InChIKey | QPPHNYKTCYXJSR-SREVYHEPSA-N |
| XLogP | 5.23 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.01 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|