C24H23ClO5S — CID 158675985
5-[(Z)-2-[2-[(4-chlorophenyl)sulfonylmethyl]phenyl]ethenyl]-1,2,3-trimethoxybenzene (PubChem CID 158675985) has the molecular formula C24H23ClO5S and a molecular weight of 458.96 g/mol. Its IUPAC name is 5-[(Z)-2-[2-[(4-chlorophenyl)sulfonylmethyl]phenyl]ethenyl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[(Z)-2-[2-[(4-chlorophenyl)sulfonylmethyl]phenyl]ethenyl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 158675985 |
| Molecular Formula | C24H23ClO5S |
| Molecular Weight | 458.96 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | 5-[(Z)-2-[2-[(4-chlorophenyl)sulfonylmethyl]phenyl]ethenyl]-1,2,3-trimethoxybenzene |
| SMILES | COc1cc(/C=C\c2ccccc2CS(=O)(=O)c2ccc(Cl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H23ClO5S/c1-28-22-14-17(15-23(29-2)24(22)30-3)8-9-18-6-4-5-7-19(18)16-31(26,27)21-12-10-20(25)11-13-21/h4-15H,16H2,1-3H3/b9-8- |
| InChIKey | KHLUITBLAZANFA-HJWRWDBZSA-N |
| XLogP | 5.51 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.96 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|