C32H32O6 — CID 59742495
1,4-bis[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]naphthalene (PubChem CID 59742495) has the molecular formula C32H32O6 and a molecular weight of 512.60 g/mol. Its IUPAC name is 1,4-bis[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]naphthalene.
| Compound Name | 1,4-bis[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]naphthalene |
|---|---|
| PubChem CID | 59742495 |
| Molecular Formula | C32H32O6 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 1,4-bis[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]naphthalene |
| SMILES | COc1cc(/C=C/c2ccc(/C=C/c3cc(OC)c(OC)c(OC)c3)c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C32H32O6/c1-33-27-17-21(18-28(34-2)31(27)37-5)11-13-23-15-16-24(26-10-8-7-9-25(23)26)14-12-22-19-29(35-3)32(38-6)30(20-22)36-4/h7-20H,1-6H3/b13-11+,14-12+ |
| InChIKey | UERFXMWSAMAQJI-PHEQNACWSA-N |
| XLogP | 7.23 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|