C18H19FO4 — CID 175460433
5-[(E)-2-(4-fluoro-2-methoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene (PubChem CID 175460433) has the molecular formula C18H19FO4 and a molecular weight of 318.34 g/mol. Its IUPAC name is 5-[(E)-2-(4-fluoro-2-methoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[(E)-2-(4-fluoro-2-methoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 175460433 |
| Molecular Formula | C18H19FO4 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 5-[(E)-2-(4-fluoro-2-methoxyphenyl)ethenyl]-1,2,3-trimethoxybenzene |
| SMILES | COc1cc(F)ccc1/C=C/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H19FO4/c1-20-15-11-14(19)8-7-13(15)6-5-12-9-16(21-2)18(23-4)17(10-12)22-3/h5-11H,1-4H3/b6-5+ |
| InChIKey | HEZYSGYILQUUQB-AATRIKPKSA-N |
| XLogP | 4.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|