C26H30FNO5S — CID 145072270
ethane;2-[(4-fluorophenyl)sulfanylamino]-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol (PubChem CID 145072270) has the molecular formula C26H30FNO5S and a molecular weight of 487.59 g/mol. Its IUPAC name is ethane;2-[(4-fluorophenyl)sulfanylamino]-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol.
| Compound Name | ethane;2-[(4-fluorophenyl)sulfanylamino]-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 145072270 |
| Molecular Formula | C26H30FNO5S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | ethane;2-[(4-fluorophenyl)sulfanylamino]-6-methoxy-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
| SMILES | CC.COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)c(NSc2ccc(F)cc2)c1O |
| InChI | InChI=1S/C24H24FNO5S.C2H6/c1-28-19-12-7-16(22(23(19)27)26-32-18-10-8-17(25)9-11-18)6-5-15-13-20(29-2)24(31-4)21(14-15)30-3;1-2/h5-14,26-27H,1-4H3;1-2H3/b6-5-; |
| InChIKey | DFVZFMPGLIHFPU-YSMBQZINSA-N |
| XLogP | 6.88 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|