C24H23ClFNO4S — CID 145072205
N-(4-chlorophenyl)sulfanyl-2-fluoro-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline (PubChem CID 145072205) has the molecular formula C24H23ClFNO4S and a molecular weight of 475.97 g/mol. Its IUPAC name is N-(4-chlorophenyl)sulfanyl-2-fluoro-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline.
| Compound Name | N-(4-chlorophenyl)sulfanyl-2-fluoro-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
|---|---|
| PubChem CID | 145072205 |
| Molecular Formula | C24H23ClFNO4S |
| Molecular Weight | 475.97 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | N-(4-chlorophenyl)sulfanyl-2-fluoro-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)c(NSc2ccc(Cl)cc2)c1F |
| InChI | InChI=1S/C24H23ClFNO4S/c1-28-19-12-7-16(23(22(19)26)27-32-18-10-8-17(25)9-11-18)6-5-15-13-20(29-2)24(31-4)21(14-15)30-3/h5-14,27H,1-4H3/b6-5- |
| InChIKey | RKTMOVXTHGFOEZ-WAYWQWQTSA-N |
| XLogP | 6.80 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.97 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|