C24H22F3NO3S — CID 145072366
N-[4-(trifluoromethyl)phenyl]sulfanyl-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline (PubChem CID 145072366) has the molecular formula C24H22F3NO3S and a molecular weight of 461.51 g/mol. Its IUPAC name is N-[4-(trifluoromethyl)phenyl]sulfanyl-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline.
| Compound Name | N-[4-(trifluoromethyl)phenyl]sulfanyl-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
|---|---|
| PubChem CID | 145072366 |
| Molecular Formula | C24H22F3NO3S |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | N-[4-(trifluoromethyl)phenyl]sulfanyl-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
| SMILES | COc1cc(/C=C\c2cccc(NSc3ccc(C(F)(F)F)cc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H22F3NO3S/c1-29-21-14-17(15-22(30-2)23(21)31-3)8-7-16-5-4-6-19(13-16)28-32-20-11-9-18(10-12-20)24(25,26)27/h4-15,28H,1-3H3/b8-7- |
| InChIKey | YLPXLFKTWYMJQO-FPLPWBNLSA-N |
| XLogP | 7.02 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|