C26H25NO4 — CID 135359677
3-phenyl-N-[3-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide (PubChem CID 135359677) has the molecular formula C26H25NO4 and a molecular weight of 415.49 g/mol. Its IUPAC name is 3-phenyl-N-[3-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide.
| Compound Name | 3-phenyl-N-[3-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135359677 |
| Molecular Formula | C26H25NO4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 3-phenyl-N-[3-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
| SMILES | COc1cc(C=Cc2cccc(NC(=O)C=Cc3ccccc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C26H25NO4/c1-29-23-17-21(18-24(30-2)26(23)31-3)13-12-20-10-7-11-22(16-20)27-25(28)15-14-19-8-5-4-6-9-19/h4-18H,1-3H3,(H,27,28) |
| InChIKey | APTMBUANBSKQLH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|