C26H25NO5 — CID 135360057
(E)-3-(3-hydroxyphenyl)-N-[4-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide (PubChem CID 135360057) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is (E)-3-(3-hydroxyphenyl)-N-[4-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-hydroxyphenyl)-N-[4-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135360057 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (E)-3-(3-hydroxyphenyl)-N-[4-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
| SMILES | COc1cc(C=Cc2ccc(NC(=O)/C=C/c3cccc(O)c3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C26H25NO5/c1-30-23-16-20(17-24(31-2)26(23)32-3)8-7-18-9-12-21(13-10-18)27-25(29)14-11-19-5-4-6-22(28)15-19/h4-17,28H,1-3H3,(H,27,29)/b8-7?,14-11+ |
| InChIKey | UJQWVFDXSBGGLN-NLAFVXNKSA-N |
| XLogP | 5.24 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|