C27H27NO5 — CID 135359675
(E)-3-(3-methoxyphenyl)-N-[3-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide (PubChem CID 135359675) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is (E)-3-(3-methoxyphenyl)-N-[3-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-methoxyphenyl)-N-[3-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135359675 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | (E)-3-(3-methoxyphenyl)-N-[3-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)Nc2cccc(/C=C/c3cc(OC)c(OC)c(OC)c3)c2)c1 |
| InChI | InChI=1S/C27H27NO5/c1-30-23-10-6-8-20(16-23)13-14-26(29)28-22-9-5-7-19(15-22)11-12-21-17-24(31-2)27(33-4)25(18-21)32-3/h5-18H,1-4H3,(H,28,29)/b12-11+,14-13+ |
| InChIKey | FDWJBOLXTBFIET-LDHFCIDVSA-N |
| XLogP | 5.54 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|