C20H23NO6 — CID 26703055
(E)-3-(3,5-dimethoxyphenyl)-N-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 26703055) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxyphenyl)-N-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3,5-dimethoxyphenyl)-N-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 26703055 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (E)-3-(3,5-dimethoxyphenyl)-N-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cc(OC)c(OC)c(OC)c2)cc(OC)c1 |
| InChI | InChI=1S/C20H23NO6/c1-23-15-8-13(9-16(12-15)24-2)6-7-19(22)21-14-10-17(25-3)20(27-5)18(11-14)26-4/h6-12H,1-5H3,(H,21,22)/b7-6+ |
| InChIKey | KFZZZYXSDGHLDP-VOTSOKGWSA-N |
| XLogP | 3.38 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|