C20H21NO6 — CID 90670908
[4-[(E)-3-oxo-3-(3,4,5-trimethoxyanilino)prop-1-enyl]phenyl] acetate (PubChem CID 90670908) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is [4-[(E)-3-oxo-3-(3,4,5-trimethoxyanilino)prop-1-enyl]phenyl] acetate.
| Compound Name | [4-[(E)-3-oxo-3-(3,4,5-trimethoxyanilino)prop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 90670908 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | [4-[(E)-3-oxo-3-(3,4,5-trimethoxyanilino)prop-1-enyl]phenyl] acetate |
| SMILES | COc1cc(NC(=O)/C=C/c2ccc(OC(C)=O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H21NO6/c1-13(22)27-16-8-5-14(6-9-16)7-10-19(23)21-15-11-17(24-2)20(26-4)18(12-15)25-3/h5-12H,1-4H3,(H,21,23)/b10-7+ |
| InChIKey | RVOHKTOBKXVBJR-JXMROGBWSA-N |
| XLogP | 3.29 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|