C21H25NO7 — CID 78566887
N,3-bis(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 78566887) has the molecular formula C21H25NO7 and a molecular weight of 403.43 g/mol. Its IUPAC name is N,3-bis(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | N,3-bis(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 78566887 |
| Molecular Formula | C21H25NO7 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | N,3-bis(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C21H25NO7/c1-24-15-9-13(10-16(25-2)20(15)28-5)7-8-19(23)22-14-11-17(26-3)21(29-6)18(12-14)27-4/h7-12H,1-6H3,(H,22,23) |
| InChIKey | NZMRVDXQFIOOFT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|