C28H34F3NO3S — CID 145072365
ethane;N-[4-(trifluoromethyl)phenyl]sulfanyl-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline (PubChem CID 145072365) has the molecular formula C28H34F3NO3S and a molecular weight of 521.65 g/mol. Its IUPAC name is ethane;N-[4-(trifluoromethyl)phenyl]sulfanyl-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline.
| Compound Name | ethane;N-[4-(trifluoromethyl)phenyl]sulfanyl-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
|---|---|
| PubChem CID | 145072365 |
| Molecular Formula | C28H34F3NO3S |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | ethane;N-[4-(trifluoromethyl)phenyl]sulfanyl-3-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
| SMILES | CC.CC.COc1cc(/C=C\c2cccc(NSc3ccc(C(F)(F)F)cc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C24H22F3NO3S.2C2H6/c1-29-21-14-17(15-22(30-2)23(21)31-3)8-7-16-5-4-6-19(13-16)28-32-20-11-9-18(10-12-20)24(25,26)27;2*1-2/h4-15,28H,1-3H3;2*1-2H3/b8-7-;; |
| InChIKey | WAMKQAXZIXECKG-OTMFCZTRSA-N |
| XLogP | 9.07 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|