C29H35F4NO4S — CID 145072385
ethane;3-fluoro-2-methoxy-N-[3-(trifluoromethyl)phenyl]sulfanyl-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline (PubChem CID 145072385) has the molecular formula C29H35F4NO4S and a molecular weight of 569.66 g/mol. Its IUPAC name is ethane;3-fluoro-2-methoxy-N-[3-(trifluoromethyl)phenyl]sulfanyl-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline.
| Compound Name | ethane;3-fluoro-2-methoxy-N-[3-(trifluoromethyl)phenyl]sulfanyl-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
|---|---|
| PubChem CID | 145072385 |
| Molecular Formula | C29H35F4NO4S |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | ethane;3-fluoro-2-methoxy-N-[3-(trifluoromethyl)phenyl]sulfanyl-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
| SMILES | CC.CC.COc1cc(/C=C\c2ccc(F)c(OC)c2NSc2cccc(C(F)(F)F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C25H23F4NO4S.2C2H6/c1-31-20-12-15(13-21(32-2)24(20)34-4)8-9-16-10-11-19(26)23(33-3)22(16)30-35-18-7-5-6-17(14-18)25(27,28)29;2*1-2/h5-14,30H,1-4H3;2*1-2H3/b9-8-;; |
| InChIKey | AJJSNZVPJFHWOF-ULDSSAIZSA-N |
| XLogP | 9.22 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|