C24H25FN2O4S — CID 145072399
N-(3-aminophenyl)sulfanyl-2-fluoro-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline (PubChem CID 145072399) has the molecular formula C24H25FN2O4S and a molecular weight of 456.54 g/mol. Its IUPAC name is N-(3-aminophenyl)sulfanyl-2-fluoro-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline.
| Compound Name | N-(3-aminophenyl)sulfanyl-2-fluoro-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
|---|---|
| PubChem CID | 145072399 |
| Molecular Formula | C24H25FN2O4S |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N-(3-aminophenyl)sulfanyl-2-fluoro-3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)c(NSc2cccc(N)c2)c1F |
| InChI | InChI=1S/C24H25FN2O4S/c1-28-19-11-10-16(23(22(19)25)27-32-18-7-5-6-17(26)14-18)9-8-15-12-20(29-2)24(31-4)21(13-15)30-3/h5-14,27H,26H2,1-4H3/b9-8- |
| InChIKey | DDLUWEUYXHCGJA-HJWRWDBZSA-N |
| XLogP | 5.73 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|