C26H29NO7S — CID 145072351
5-[4,5-dimethoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]sulfanyl-2-methoxyphenol (PubChem CID 145072351) has the molecular formula C26H29NO7S and a molecular weight of 499.59 g/mol. Its IUPAC name is 5-[4,5-dimethoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]sulfanyl-2-methoxyphenol.
| Compound Name | 5-[4,5-dimethoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]sulfanyl-2-methoxyphenol |
|---|---|
| PubChem CID | 145072351 |
| Molecular Formula | C26H29NO7S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 5-[4,5-dimethoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]sulfanyl-2-methoxyphenol |
| SMILES | COc1ccc(SNc2cc(OC)c(OC)cc2/C=C\c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C26H29NO7S/c1-29-21-10-9-18(14-20(21)28)35-27-19-15-23(31-3)22(30-2)13-17(19)8-7-16-11-24(32-4)26(34-6)25(12-16)33-5/h7-15,27-28H,1-6H3/b8-7- |
| InChIKey | ZQDFPPATKWWUOP-FPLPWBNLSA-N |
| XLogP | 5.73 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|