C24H24N2O7S — CID 145072222
2-methoxy-6-[(3-nitrophenyl)sulfanylamino]-4-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol (PubChem CID 145072222) has the molecular formula C24H24N2O7S and a molecular weight of 484.53 g/mol. Its IUPAC name is 2-methoxy-6-[(3-nitrophenyl)sulfanylamino]-4-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol.
| Compound Name | 2-methoxy-6-[(3-nitrophenyl)sulfanylamino]-4-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
|---|---|
| PubChem CID | 145072222 |
| Molecular Formula | C24H24N2O7S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 2-methoxy-6-[(3-nitrophenyl)sulfanylamino]-4-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenol |
| SMILES | COc1cc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc(NSc2cccc([N+](=O)[O-])c2)c1O |
| InChI | InChI=1S/C24H24N2O7S/c1-30-20-11-15(8-9-16-12-21(31-2)24(33-4)22(13-16)32-3)10-19(23(20)27)25-34-18-7-5-6-17(14-18)26(28)29/h5-14,25,27H,1-4H3/b9-8- |
| InChIKey | XJYDELKLVXRWRZ-HJWRWDBZSA-N |
| XLogP | 5.62 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|