C27H31NO10S — CID 121315017
N-[2-hydroxy-3-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3,4,5-trimethoxybenzenesulfonamide (PubChem CID 121315017) has the molecular formula C27H31NO10S and a molecular weight of 561.61 g/mol. Its IUPAC name is N-[2-hydroxy-3-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3,4,5-trimethoxybenzenesulfonamide.
| Compound Name | N-[2-hydroxy-3-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3,4,5-trimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 121315017 |
| Molecular Formula | C27H31NO10S |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | N-[2-hydroxy-3-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-3,4,5-trimethoxybenzenesulfonamide |
| SMILES | COc1cc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc(NS(=O)(=O)c2cc(OC)c(OC)c(OC)c2)c1O |
| InChI | InChI=1S/C27H31NO10S/c1-32-20-11-16(8-9-17-12-21(33-2)26(37-6)22(13-17)34-3)10-19(25(20)29)28-39(30,31)18-14-23(35-4)27(38-7)24(15-18)36-5/h8-15,28-29H,1-7H3/b9-8- |
| InChIKey | GCDCZNZHPGYVLF-HJWRWDBZSA-N |
| XLogP | 4.42 |
| TPSA | 131.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|