C24H24ClNO6S — CID 121314897
3-chloro-N-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide (PubChem CID 121314897) has the molecular formula C24H24ClNO6S and a molecular weight of 489.98 g/mol. Its IUPAC name is 3-chloro-N-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121314897 |
| Molecular Formula | C24H24ClNO6S |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | 3-chloro-N-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1NS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H24ClNO6S/c1-29-21-11-10-16(8-9-17-13-22(30-2)24(32-4)23(14-17)31-3)12-20(21)26-33(27,28)19-7-5-6-18(25)15-19/h5-15,26H,1-4H3/b9-8- |
| InChIKey | FMTXITJMRFGVEC-HJWRWDBZSA-N |
| XLogP | 5.35 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|