C29H35NO7S — CID 121315042
3-tert-butyl-N-[2,3-dimethoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide (PubChem CID 121315042) has the molecular formula C29H35NO7S and a molecular weight of 541.67 g/mol. Its IUPAC name is 3-tert-butyl-N-[2,3-dimethoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide.
| Compound Name | 3-tert-butyl-N-[2,3-dimethoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121315042 |
| Molecular Formula | C29H35NO7S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | 3-tert-butyl-N-[2,3-dimethoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide |
| SMILES | COc1cc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc(NS(=O)(=O)c2cccc(C(C)(C)C)c2)c1OC |
| InChI | InChI=1S/C29H35NO7S/c1-29(2,3)21-10-9-11-22(18-21)38(31,32)30-23-14-19(15-24(33-4)27(23)36-7)12-13-20-16-25(34-5)28(37-8)26(17-20)35-6/h9-18,30H,1-8H3/b13-12- |
| InChIKey | XRRTWCHKLUYCSL-SEYXRHQNSA-N |
| XLogP | 6.00 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|