C28H33NO7S — CID 121314883
4-tert-butyl-N-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide (PubChem CID 121314883) has the molecular formula C28H33NO7S and a molecular weight of 527.64 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121314883 |
| Molecular Formula | C28H33NO7S |
| Molecular Weight | 527.64 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 4-tert-butyl-N-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]benzenesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(C(C)(C)C)cc2)c(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C28H33NO7S/c1-28(2,3)20-10-12-21(13-11-20)37(31,32)29-22-17-24(33-4)23(30)16-19(22)9-8-18-14-25(34-5)27(36-7)26(15-18)35-6/h8-17,29-30H,1-7H3/b9-8- |
| InChIKey | SZWOTJJWMDYHPT-HJWRWDBZSA-N |
| XLogP | 5.70 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.64 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|