C28H32N2O7 — CID 134378119
1-(3-amino-4-methoxyphenyl)-3-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]propan-1-one (PubChem CID 134378119) has the molecular formula C28H32N2O7 and a molecular weight of 508.57 g/mol. Its IUPAC name is 1-(3-amino-4-methoxyphenyl)-3-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]propan-1-one.
| Compound Name | 1-(3-amino-4-methoxyphenyl)-3-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]propan-1-one |
|---|---|
| PubChem CID | 134378119 |
| Molecular Formula | C28H32N2O7 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 1-(3-amino-4-methoxyphenyl)-3-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]propan-1-one |
| SMILES | COc1ccc(C(=O)CCNc2cc(OC)c(O)cc2/C=C\c2cc(OC)c(OC)c(OC)c2)cc1N |
| InChI | InChI=1S/C28H32N2O7/c1-33-24-9-8-19(14-20(24)29)22(31)10-11-30-21-16-25(34-2)23(32)15-18(21)7-6-17-12-26(35-3)28(37-5)27(13-17)36-4/h6-9,12-16,30,32H,10-11,29H2,1-5H3/b7-6- |
| InChIKey | SYXGDIHVUQZTAD-SREVYHEPSA-N |
| XLogP | 4.87 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|