C28H28FNO7 — CID 154202208
1-(3-fluoro-4-methoxyphenyl)-3-[4-hydroxy-5-methoxy-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one (PubChem CID 154202208) has the molecular formula C28H28FNO7 and a molecular weight of 509.53 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-3-[4-hydroxy-5-methoxy-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-3-[4-hydroxy-5-methoxy-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one |
|---|---|
| PubChem CID | 154202208 |
| Molecular Formula | C28H28FNO7 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-3-[4-hydroxy-5-methoxy-2-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one |
| SMILES | COc1cc(NC=CC(=O)c2ccc(OC)c(F)c2)c(C=Cc2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C28H28FNO7/c1-33-24-9-8-19(14-20(24)29)22(31)10-11-30-21-16-25(34-2)23(32)15-18(21)7-6-17-12-26(35-3)28(37-5)27(13-17)36-4/h6-16,30,32H,1-5H3 |
| InChIKey | WRKDEFWVNPQLPO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|