C28H29NO7U — CID 163792781
carbanide;(Z)-1-(3-hydroxybenzene-4-id-1-yl)-3-[3-hydroxy-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one;uranium(2+) (PubChem CID 163792781) has the molecular formula C28H29NO7U and a molecular weight of 729.57 g/mol. Its IUPAC name is carbanide;(Z)-1-(3-hydroxybenzene-4-id-1-yl)-3-[3-hydroxy-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one;uranium(2+).
| Compound Name | carbanide;(Z)-1-(3-hydroxybenzene-4-id-1-yl)-3-[3-hydroxy-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one;uranium(2+) |
|---|---|
| PubChem CID | 163792781 |
| Molecular Formula | C28H29NO7U |
| Molecular Weight | 729.57 g/mol |
| Exact Mass | 729.25 |
| IUPAC Name | carbanide;(Z)-1-(3-hydroxybenzene-4-id-1-yl)-3-[3-hydroxy-2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]prop-2-en-1-one;uranium(2+) |
| SMILES | COc1cc(/C=C\c2cc(O)c(OC)c(N/C=C\C(=O)c3cc[c-]c(O)c3)c2)cc(OC)c1OC.[CH3-].[U+2] |
| InChI | InChI=1S/C27H26NO7.CH3.U/c1-32-24-14-18(15-25(33-2)27(24)35-4)9-8-17-12-21(26(34-3)23(31)13-17)28-11-10-22(30)19-6-5-7-20(29)16-19;;/h5-6,8-16,28-29,31H,1-4H3;1H3;/q2*-1;+2/b9-8-,11-10-;; |
| InChIKey | GBJHMLVVSIHZFB-CFJKUCMYSA-N |
| XLogP | 5.36 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|