C27H26FNO5 — CID 154189228
3-[3-fluoro-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-phenylprop-2-en-1-one (PubChem CID 154189228) has the molecular formula C27H26FNO5 and a molecular weight of 463.51 g/mol. Its IUPAC name is 3-[3-fluoro-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-phenylprop-2-en-1-one.
| Compound Name | 3-[3-fluoro-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 154189228 |
| Molecular Formula | C27H26FNO5 |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 3-[3-fluoro-2-methoxy-5-[2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-1-phenylprop-2-en-1-one |
| SMILES | COc1cc(C=Cc2cc(F)c(OC)c(NC=CC(=O)c3ccccc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C27H26FNO5/c1-31-24-16-19(17-25(32-2)27(24)34-4)11-10-18-14-21(28)26(33-3)22(15-18)29-13-12-23(30)20-8-6-5-7-9-20/h5-17,29H,1-4H3 |
| InChIKey | FBGRJUDRJIFADQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|